C14H24BrNO3S — CID 60743700
1-[(5-bromothiophen-2-yl)methylamino]-3-(2-butoxyethoxy)propan-2-ol (PubChem CID 60743700) has the molecular formula C14H24BrNO3S and a molecular weight of 366.32 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methylamino]-3-(2-butoxyethoxy)propan-2-ol.
| Compound Name | 1-[(5-bromothiophen-2-yl)methylamino]-3-(2-butoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 60743700 |
| Molecular Formula | C14H24BrNO3S |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methylamino]-3-(2-butoxyethoxy)propan-2-ol |
| SMILES | CCCCOCCOCC(O)CNCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H24BrNO3S/c1-2-3-6-18-7-8-19-11-12(17)9-16-10-13-4-5-14(15)20-13/h4-5,12,16-17H,2-3,6-11H2,1H3 |
| InChIKey | OTQCSOHELWVSLU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|