C8H13BrN2OS — CID 115121348
1-amino-3-[(5-bromothiophen-2-yl)methylamino]propan-2-ol (PubChem CID 115121348) has the molecular formula C8H13BrN2OS and a molecular weight of 265.18 g/mol. Its IUPAC name is 1-amino-3-[(5-bromothiophen-2-yl)methylamino]propan-2-ol.
| Compound Name | 1-amino-3-[(5-bromothiophen-2-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 115121348 |
| Molecular Formula | C8H13BrN2OS |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 1-amino-3-[(5-bromothiophen-2-yl)methylamino]propan-2-ol |
| SMILES | NCC(O)CNCc1ccc(Br)s1 |
| InChI | InChI=1S/C8H13BrN2OS/c9-8-2-1-7(13-8)5-11-4-6(12)3-10/h1-2,6,11-12H,3-5,10H2 |
| InChIKey | WAZLZLUELWHWMR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |