C30H25FN3O2+ — CID 10324166
2-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-4,5-bis(4-methoxyphenyl)pyrimidine (PubChem CID 10324166) has the molecular formula C30H25FN3O2+ and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-4,5-bis(4-methoxyphenyl)pyrimidine.
| Compound Name | 2-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-4,5-bis(4-methoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 10324166 |
| Molecular Formula | C30H25FN3O2+ |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-4,5-bis(4-methoxyphenyl)pyrimidine |
| SMILES | COc1ccc(-c2cnc(-c3cc[n+](Cc4cccc(F)c4)cc3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H25FN3O2/c1-35-26-10-6-22(7-11-26)28-19-32-30(33-29(28)23-8-12-27(36-2)13-9-23)24-14-16-34(17-15-24)20-21-4-3-5-25(31)18-21/h3-19H,20H2,1-2H3/q+1 |
| InChIKey | PLAZVLMSPXESTH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 48.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|