C21H18N4O10S — CID 10324301
[(2R,3R,4R,5R)-4-acetyloxy-3-cyano-5-(6-cyano-2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl benzoate (PubChem CID 10324301) has the molecular formula C21H18N4O10S and a molecular weight of 518.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-3-cyano-5-(6-cyano-2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-3-cyano-5-(6-cyano-2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10324301 |
| Molecular Formula | C21H18N4O10S |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-3-cyano-5-(6-cyano-2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1[C@H](n2c(C#N)cc(=O)[nH]c2=O)O[C@H](COC(=O)c2ccccc2)[C@@]1(C#N)OS(C)(=O)=O |
| InChI | InChI=1S/C21H18N4O10S/c1-12(26)33-17-18(25-14(9-22)8-16(27)24-20(25)29)34-15(21(17,11-23)35-36(2,30)31)10-32-19(28)13-6-4-3-5-7-13/h3-8,15,17-18H,10H2,1-2H3,(H,24,27,29)/t15-,17+,18-,21-/m1/s1 |
| InChIKey | UUOGYWIMRKWKHW-LNNXQNCSSA-N |
| XLogP | -0.67 |
| TPSA | 207.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|