2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid

C11H14N2O4 — CID 103243083

IUPAC2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid
SMILESNC(CNCc1cccc2c1OCO2)C(=O)O
InChIInChI=1S/C11H14N2O4/c12-8(11(14)15)5-13-4-7-2-1-3-9-10(7)17-6-16-9/h1-3,8,13H,4-6,12H2,(H,14,15)
InChIKeyUFFHFRALGFUXBJ-UHFFFAOYSA-N
MW238.24 g/mol
LogP-0.08
Rot. Bonds5

About 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid

2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid (PubChem CID 103243083) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid
PubChem CID103243083
Molecular FormulaC11H14N2O4
Molecular Weight238.24 g/mol
Exact Mass238.10
IUPAC Name2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid
SMILESNC(CNCc1cccc2c1OCO2)C(=O)O
InChIInChI=1S/C11H14N2O4/c12-8(11(14)15)5-13-4-7-2-1-3-9-10(7)17-6-16-9/h1-3,8,13H,4-6,12H2,(H,14,15)
InChIKeyUFFHFRALGFUXBJ-UHFFFAOYSA-N
XLogP-0.08
TPSA93.81 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 5-0.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid?
The IUPAC name of 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid (CID 103243083) is 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid.
What is the SMILES notation for 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid?
The canonical SMILES for 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid is NC(CNCc1cccc2c1OCO2)C(=O)O.
What is the InChIKey of 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid?
The InChIKey is UFFHFRALGFUXBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4/c12-8(11(14)15)5-13-4-7-2-1-3-9-10(7)17-6-16-9/h1-3,8,13H,4-6,12H2,(H,14,15).
What are the key properties of 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid?
2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid has a molecular weight of 238.24 g/mol, XLogP of -0.08, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1,3-benzodioxol-4-ylmethylamino)propanoic acid is sourced from PubChem (CID 103243083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).