C13H17NO3 — CID 55172551
2-(1,3-benzodioxol-4-ylmethylamino)-1-cyclopropylethanol (PubChem CID 55172551) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-4-ylmethylamino)-1-cyclopropylethanol.
| Compound Name | 2-(1,3-benzodioxol-4-ylmethylamino)-1-cyclopropylethanol |
|---|---|
| PubChem CID | 55172551 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(1,3-benzodioxol-4-ylmethylamino)-1-cyclopropylethanol |
| SMILES | OC(CNCc1cccc2c1OCO2)C1CC1 |
| InChI | InChI=1S/C13H17NO3/c15-11(9-4-5-9)7-14-6-10-2-1-3-12-13(10)17-8-16-12/h1-3,9,11,14-15H,4-8H2 |
| InChIKey | OGIKLPWXTRXIET-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |