C17H21NO3 — CID 103244865
2-[[(1-methylcyclohexyl)amino]methyl]-1-benzofuran-3-carboxylic acid (PubChem CID 103244865) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[[(1-methylcyclohexyl)amino]methyl]-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-[[(1-methylcyclohexyl)amino]methyl]-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 103244865 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[[(1-methylcyclohexyl)amino]methyl]-1-benzofuran-3-carboxylic acid |
| SMILES | CC1(NCc2oc3ccccc3c2C(=O)O)CCCCC1 |
| InChI | InChI=1S/C17H21NO3/c1-17(9-5-2-6-10-17)18-11-14-15(16(19)20)12-7-3-4-8-13(12)21-14/h3-4,7-8,18H,2,5-6,9-11H2,1H3,(H,19,20) |
| InChIKey | KBKBAVGBTJHKOQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |