C12H23NO2 — CID 103246914
(E)-4-(2,4,4-trimethylpentan-2-ylamino)but-2-enoic acid (PubChem CID 103246914) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (E)-4-(2,4,4-trimethylpentan-2-ylamino)but-2-enoic acid.
| Compound Name | (E)-4-(2,4,4-trimethylpentan-2-ylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103246914 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (E)-4-(2,4,4-trimethylpentan-2-ylamino)but-2-enoic acid |
| SMILES | CC(C)(C)CC(C)(C)NC/C=C/C(=O)O |
| InChI | InChI=1S/C12H23NO2/c1-11(2,3)9-12(4,5)13-8-6-7-10(14)15/h6-7,13H,8-9H2,1-5H3,(H,14,15)/b7-6+ |
| InChIKey | TUDAXNVWJDYBDB-VOTSOKGWSA-N |
| XLogP | 2.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|