C13H14N4O4 — CID 103247141
2-nitro-6-[(2-pyrazol-1-ylethylamino)methyl]benzoic acid (PubChem CID 103247141) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-nitro-6-[(2-pyrazol-1-ylethylamino)methyl]benzoic acid.
| Compound Name | 2-nitro-6-[(2-pyrazol-1-ylethylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 103247141 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-nitro-6-[(2-pyrazol-1-ylethylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1c(CNCCn2cccn2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N4O4/c18-13(19)12-10(3-1-4-11(12)17(20)21)9-14-6-8-16-7-2-5-15-16/h1-5,7,14H,6,8-9H2,(H,18,19) |
| InChIKey | FOZQRRSTOBAAHP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|