C11H14N4O5 — CID 103262437
2-[[2-(carbamoylamino)ethylamino]methyl]-6-nitrobenzoic acid (PubChem CID 103262437) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-[[2-(carbamoylamino)ethylamino]methyl]-6-nitrobenzoic acid.
| Compound Name | 2-[[2-(carbamoylamino)ethylamino]methyl]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 103262437 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[[2-(carbamoylamino)ethylamino]methyl]-6-nitrobenzoic acid |
| SMILES | NC(=O)NCCNCc1cccc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C11H14N4O5/c12-11(18)14-5-4-13-6-7-2-1-3-8(15(19)20)9(7)10(16)17/h1-3,13H,4-6H2,(H,16,17)(H3,12,14,18) |
| InChIKey | MHTRZQUGVXHMKH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|