C13H17N3O5 — CID 106097396
2-[[(4-amino-2-methyl-4-oxobutan-2-yl)amino]methyl]-6-nitrobenzoic acid (PubChem CID 106097396) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-[[(4-amino-2-methyl-4-oxobutan-2-yl)amino]methyl]-6-nitrobenzoic acid.
| Compound Name | 2-[[(4-amino-2-methyl-4-oxobutan-2-yl)amino]methyl]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 106097396 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[[(4-amino-2-methyl-4-oxobutan-2-yl)amino]methyl]-6-nitrobenzoic acid |
| SMILES | CC(C)(CC(N)=O)NCc1cccc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C13H17N3O5/c1-13(2,6-10(14)17)15-7-8-4-3-5-9(16(20)21)11(8)12(18)19/h3-5,15H,6-7H2,1-2H3,(H2,14,17)(H,18,19) |
| InChIKey | UVHLDGNIFMFHSU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|