C10H9Br2NO2 — CID 103247263
2-[(2,4-dibromoanilino)methyl]prop-2-enoic acid (PubChem CID 103247263) has the molecular formula C10H9Br2NO2 and a molecular weight of 335.00 g/mol. Its IUPAC name is 2-[(2,4-dibromoanilino)methyl]prop-2-enoic acid.
| Compound Name | 2-[(2,4-dibromoanilino)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103247263 |
| Molecular Formula | C10H9Br2NO2 |
| Molecular Weight | 335.00 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 2-[(2,4-dibromoanilino)methyl]prop-2-enoic acid |
| SMILES | C=C(CNc1ccc(Br)cc1Br)C(=O)O |
| InChI | InChI=1S/C10H9Br2NO2/c1-6(10(14)15)5-13-9-3-2-7(11)4-8(9)12/h2-4,13H,1,5H2,(H,14,15) |
| InChIKey | HTLWYXKIHLLOOX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.00 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|