C8H13BrF3NO3 — CID 103251698
methyl 2-bromo-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propanoate (PubChem CID 103251698) has the molecular formula C8H13BrF3NO3 and a molecular weight of 308.09 g/mol. Its IUPAC name is methyl 2-bromo-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propanoate.
| Compound Name | methyl 2-bromo-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propanoate |
|---|---|
| PubChem CID | 103251698 |
| Molecular Formula | C8H13BrF3NO3 |
| Molecular Weight | 308.09 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | methyl 2-bromo-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propanoate |
| SMILES | COC(=O)C(Br)CNCCOCC(F)(F)F |
| InChI | InChI=1S/C8H13BrF3NO3/c1-15-7(14)6(9)4-13-2-3-16-5-8(10,11)12/h6,13H,2-5H2,1H3 |
| InChIKey | HBOBDDLNOSZLMG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.09 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|