C9H15BrF3NO3 — CID 103492218
methyl 2-bromo-3-[3-(2,2,2-trifluoroethoxy)propylamino]propanoate (PubChem CID 103492218) has the molecular formula C9H15BrF3NO3 and a molecular weight of 322.12 g/mol. Its IUPAC name is methyl 2-bromo-3-[3-(2,2,2-trifluoroethoxy)propylamino]propanoate.
| Compound Name | methyl 2-bromo-3-[3-(2,2,2-trifluoroethoxy)propylamino]propanoate |
|---|---|
| PubChem CID | 103492218 |
| Molecular Formula | C9H15BrF3NO3 |
| Molecular Weight | 322.12 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | methyl 2-bromo-3-[3-(2,2,2-trifluoroethoxy)propylamino]propanoate |
| SMILES | COC(=O)C(Br)CNCCCOCC(F)(F)F |
| InChI | InChI=1S/C9H15BrF3NO3/c1-16-8(15)7(10)5-14-3-2-4-17-6-9(11,12)13/h7,14H,2-6H2,1H3 |
| InChIKey | DOZKXASJIOHDJB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|