C12H24F3NO2 — CID 107152188
4,4-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propylamino]pentan-2-ol (PubChem CID 107152188) has the molecular formula C12H24F3NO2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4,4-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propylamino]pentan-2-ol.
| Compound Name | 4,4-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propylamino]pentan-2-ol |
|---|---|
| PubChem CID | 107152188 |
| Molecular Formula | C12H24F3NO2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 4,4-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propylamino]pentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H24F3NO2/c1-11(2,3)7-10(17)8-16-5-4-6-18-9-12(13,14)15/h10,16-17H,4-9H2,1-3H3 |
| InChIKey | YDCOVFLOVVWJBQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|