C14H16F3NO2 — CID 103255420
(Z)-2-ethyl-4-[2-methyl-5-(trifluoromethyl)anilino]but-2-enoic acid (PubChem CID 103255420) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is (Z)-2-ethyl-4-[2-methyl-5-(trifluoromethyl)anilino]but-2-enoic acid.
| Compound Name | (Z)-2-ethyl-4-[2-methyl-5-(trifluoromethyl)anilino]but-2-enoic acid |
|---|---|
| PubChem CID | 103255420 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (Z)-2-ethyl-4-[2-methyl-5-(trifluoromethyl)anilino]but-2-enoic acid |
| SMILES | CC/C(=C/CNc1cc(C(F)(F)F)ccc1C)C(=O)O |
| InChI | InChI=1S/C14H16F3NO2/c1-3-10(13(19)20)6-7-18-12-8-11(14(15,16)17)5-4-9(12)2/h4-6,8,18H,3,7H2,1-2H3,(H,19,20)/b10-6- |
| InChIKey | MFWWWEXXFPQCGW-POHAHGRESA-N |
| XLogP | 3.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|