C13H14F3NO3 — CID 103233373
(Z)-2-ethyl-4-[4-(trifluoromethoxy)anilino]but-2-enoic acid (PubChem CID 103233373) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is (Z)-2-ethyl-4-[4-(trifluoromethoxy)anilino]but-2-enoic acid.
| Compound Name | (Z)-2-ethyl-4-[4-(trifluoromethoxy)anilino]but-2-enoic acid |
|---|---|
| PubChem CID | 103233373 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (Z)-2-ethyl-4-[4-(trifluoromethoxy)anilino]but-2-enoic acid |
| SMILES | CC/C(=C/CNc1ccc(OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C13H14F3NO3/c1-2-9(12(18)19)7-8-17-10-3-5-11(6-4-10)20-13(14,15)16/h3-7,17H,2,8H2,1H3,(H,18,19)/b9-7- |
| InChIKey | OJNURKSMZFJHQT-CLFYSBASSA-N |
| XLogP | 3.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|