C7H13N5O — CID 103256769
2-amino-3-[(1-methylpyrazol-4-yl)amino]propanamide (PubChem CID 103256769) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 2-amino-3-[(1-methylpyrazol-4-yl)amino]propanamide.
| Compound Name | 2-amino-3-[(1-methylpyrazol-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 103256769 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-amino-3-[(1-methylpyrazol-4-yl)amino]propanamide |
| SMILES | Cn1cc(NCC(N)C(N)=O)cn1 |
| InChI | InChI=1S/C7H13N5O/c1-12-4-5(2-11-12)10-3-6(8)7(9)13/h2,4,6,10H,3,8H2,1H3,(H2,9,13) |
| InChIKey | GYEIHIVTYFJKPI-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |