C10H13N3O2 — CID 79770661
1-(furan-2-yl)-2-[(1-methylpyrazol-4-yl)amino]ethanol (PubChem CID 79770661) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[(1-methylpyrazol-4-yl)amino]ethanol.
| Compound Name | 1-(furan-2-yl)-2-[(1-methylpyrazol-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 79770661 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-(furan-2-yl)-2-[(1-methylpyrazol-4-yl)amino]ethanol |
| SMILES | Cn1cc(NCC(O)c2ccco2)cn1 |
| InChI | InChI=1S/C10H13N3O2/c1-13-7-8(5-12-13)11-6-9(14)10-3-2-4-15-10/h2-5,7,9,11,14H,6H2,1H3 |
| InChIKey | DLVPNTYBOZQNFF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |