C13H27NO3 — CID 103259123
4-(2,2-dimethylheptylamino)-3-hydroxybutanoic acid (PubChem CID 103259123) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is 4-(2,2-dimethylheptylamino)-3-hydroxybutanoic acid.
| Compound Name | 4-(2,2-dimethylheptylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 103259123 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 4-(2,2-dimethylheptylamino)-3-hydroxybutanoic acid |
| SMILES | CCCCCC(C)(C)CNCC(O)CC(=O)O |
| InChI | InChI=1S/C13H27NO3/c1-4-5-6-7-13(2,3)10-14-9-11(15)8-12(16)17/h11,14-15H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | VZXSKIHGLYFFPG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|