C16H20N2O2S — CID 103260528
4-[[3-(dimethylamino)-4-methylanilino]methyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 103260528) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-[[3-(dimethylamino)-4-methylanilino]methyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[[3-(dimethylamino)-4-methylanilino]methyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103260528 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-[[3-(dimethylamino)-4-methylanilino]methyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1ccc(NCc2cc(C(=O)O)sc2C)cc1N(C)C |
| InChI | InChI=1S/C16H20N2O2S/c1-10-5-6-13(8-14(10)18(3)4)17-9-12-7-15(16(19)20)21-11(12)2/h5-8,17H,9H2,1-4H3,(H,19,20) |
| InChIKey | NCVYNADXEFPMGZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |