C8H12F3NO3 — CID 103261666
methyl 2-methyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate (PubChem CID 103261666) has the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. Its IUPAC name is methyl 2-methyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate.
| Compound Name | methyl 2-methyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate |
|---|---|
| PubChem CID | 103261666 |
| Molecular Formula | C8H12F3NO3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | methyl 2-methyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate |
| SMILES | COC(=O)C(C)=CCNOCC(F)(F)F |
| InChI | InChI=1S/C8H12F3NO3/c1-6(7(13)14-2)3-4-12-15-5-8(9,10)11/h3,12H,4-5H2,1-2H3 |
| InChIKey | GVHULWKDNSWGOT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|