C9H14F3NO3 — CID 103262131
2-[(cyclopentyloxyamino)methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 103262131) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is 2-[(cyclopentyloxyamino)methyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[(cyclopentyloxyamino)methyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 103262131 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[(cyclopentyloxyamino)methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | O=C(O)C(CNOC1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO3/c10-9(11,12)7(8(14)15)5-13-16-6-3-1-2-4-6/h6-7,13H,1-5H2,(H,14,15) |
| InChIKey | WNRQSGRAAONDNQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|