3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid

C11H17F3O4 — CID 103372348

IUPAC3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid
SMILESCOC1CCCC(OCC(C(=O)O)C(F)(F)F)C1
InChIInChI=1S/C11H17F3O4/c1-17-7-3-2-4-8(5-7)18-6-9(10(15)16)11(12,13)14/h7-9H,2-6H2,1H3,(H,15,16)
InChIKeyIOVHTGPRPAJTNI-UHFFFAOYSA-N
MW270.25 g/mol
LogP2.22
Rot. Bonds5

About 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid

3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid (PubChem CID 103372348) has the molecular formula C11H17F3O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid.

Molecular Properties

Compound Name3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid
PubChem CID103372348
Molecular FormulaC11H17F3O4
Molecular Weight270.25 g/mol
Exact Mass270.11
IUPAC Name3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid
SMILESCOC1CCCC(OCC(C(=O)O)C(F)(F)F)C1
InChIInChI=1S/C11H17F3O4/c1-17-7-3-2-4-8(5-7)18-6-9(10(15)16)11(12,13)14/h7-9H,2-6H2,1H3,(H,15,16)
InChIKeyIOVHTGPRPAJTNI-UHFFFAOYSA-N
XLogP2.22
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.25
LogP ≤ 52.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid?
The IUPAC name of 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid (CID 103372348) is 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid.
What is the SMILES notation for 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid?
The canonical SMILES for 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid is COC1CCCC(OCC(C(=O)O)C(F)(F)F)C1.
What is the InChIKey of 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid?
The InChIKey is IOVHTGPRPAJTNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3O4/c1-17-7-3-2-4-8(5-7)18-6-9(10(15)16)11(12,13)14/h7-9H,2-6H2,1H3,(H,15,16).
What are the key properties of 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid?
3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid has a molecular weight of 270.25 g/mol, XLogP of 2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoro-2-[(3-methoxycyclohexyl)oxymethyl]propanoic acid is sourced from PubChem (CID 103372348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).