5-(2-carbamoyloxyethylamino)pentanoic acid

C8H16N2O4 — CID 103262155

IUPAC5-(2-carbamoyloxyethylamino)pentanoic acid
SMILESNC(=O)OCCNCCCCC(=O)O
InChIInChI=1S/C8H16N2O4/c9-8(13)14-6-5-10-4-2-1-3-7(11)12/h10H,1-6H2,(H2,9,13)(H,11,12)
InChIKeyIAZMZOBVWBNVGV-UHFFFAOYSA-N
MW204.23 g/mol
LogP-0.07
Rot. Bonds8

About 5-(2-carbamoyloxyethylamino)pentanoic acid

5-(2-carbamoyloxyethylamino)pentanoic acid (PubChem CID 103262155) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-(2-carbamoyloxyethylamino)pentanoic acid.

Molecular Properties

Compound Name5-(2-carbamoyloxyethylamino)pentanoic acid
PubChem CID103262155
Molecular FormulaC8H16N2O4
Molecular Weight204.23 g/mol
Exact Mass204.11
IUPAC Name5-(2-carbamoyloxyethylamino)pentanoic acid
SMILESNC(=O)OCCNCCCCC(=O)O
InChIInChI=1S/C8H16N2O4/c9-8(13)14-6-5-10-4-2-1-3-7(11)12/h10H,1-6H2,(H2,9,13)(H,11,12)
InChIKeyIAZMZOBVWBNVGV-UHFFFAOYSA-N
XLogP-0.07
TPSA101.65 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.23
LogP ≤ 5-0.07
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(2-carbamoyloxyethylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(3-aminopropylamino)ethyl carbamate
CID 83209629
11-[2-[2-[2-[2-(5-carboxypentylamino)ethylamino]ethylamino]ethylamino]ethylamino]undecanoic acid
CID 18956800
15-(3-carboxypropylamino)pentadecanoic acid
CID 87379366
14-(2-aminoethylamino)tetradecanoic acid
CID 173203671
2-[(3-amino-3-oxopropyl)amino]ethyl carbamate
CID 83211468
5-(3-methoxypropylamino)pentanoic acid
CID 103237135
4-(3-carboxypropylamino)butanoic acid
CID 4072500
5-[2-[2-(2-ethoxyethoxy)ethoxy]ethylamino]pentanoic acid
CID 175739046
4-(3-aminopropylamino)butyl carbamate
CID 175431367
4-[2-[11-[2-(3-carboxypropylamino)ethylamino]undecylamino]ethylamino]butanoic acid
CID 87391029
2-(4-methylpentylamino)ethyl carbamate
CID 83210369
5-(5-hydroxypentylamino)pentanoic acid
CID 107318223

Frequently Asked Questions

What is the IUPAC name of 5-(2-carbamoyloxyethylamino)pentanoic acid?
The IUPAC name of 5-(2-carbamoyloxyethylamino)pentanoic acid (CID 103262155) is 5-(2-carbamoyloxyethylamino)pentanoic acid.
What is the SMILES notation for 5-(2-carbamoyloxyethylamino)pentanoic acid?
The canonical SMILES for 5-(2-carbamoyloxyethylamino)pentanoic acid is NC(=O)OCCNCCCCC(=O)O.
What is the InChIKey of 5-(2-carbamoyloxyethylamino)pentanoic acid?
The InChIKey is IAZMZOBVWBNVGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4/c9-8(13)14-6-5-10-4-2-1-3-7(11)12/h10H,1-6H2,(H2,9,13)(H,11,12).
What are the key properties of 5-(2-carbamoyloxyethylamino)pentanoic acid?
5-(2-carbamoyloxyethylamino)pentanoic acid has a molecular weight of 204.23 g/mol, XLogP of -0.07, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-carbamoyloxyethylamino)pentanoic acid is sourced from PubChem (CID 103262155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).