5-(5-hydroxypentylamino)pentanoic acid

C10H21NO3 — CID 107318223

IUPAC5-(5-hydroxypentylamino)pentanoic acid
SMILESO=C(O)CCCCNCCCCCO
InChIInChI=1S/C10H21NO3/c12-9-5-1-3-7-11-8-4-2-6-10(13)14/h11-12H,1-9H2,(H,13,14)
InChIKeyPRCCPRVKZDDRAF-UHFFFAOYSA-N
MW203.28 g/mol
LogP0.99
Rot. Bonds10

About 5-(5-hydroxypentylamino)pentanoic acid

5-(5-hydroxypentylamino)pentanoic acid (PubChem CID 107318223) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 5-(5-hydroxypentylamino)pentanoic acid.

Molecular Properties

Compound Name5-(5-hydroxypentylamino)pentanoic acid
PubChem CID107318223
Molecular FormulaC10H21NO3
Molecular Weight203.28 g/mol
Exact Mass203.15
IUPAC Name5-(5-hydroxypentylamino)pentanoic acid
SMILESO=C(O)CCCCNCCCCCO
InChIInChI=1S/C10H21NO3/c12-9-5-1-3-7-11-8-4-2-6-10(13)14/h11-12H,1-9H2,(H,13,14)
InChIKeyPRCCPRVKZDDRAF-UHFFFAOYSA-N
XLogP0.99
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.28
LogP ≤ 50.99
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(5-hydroxypentylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

11-[2-[2-[2-[2-(5-carboxypentylamino)ethylamino]ethylamino]ethylamino]ethylamino]undecanoic acid
CID 18956800
15-(3-carboxypropylamino)pentadecanoic acid
CID 87379366
4-[4-[13-(2-hydroxyethylamino)tridecylamino]butylamino]butanoic acid
CID 141446490
38-hydroxyoctatriacontanoic acid
CID 18981443
10-hydroxydecanoic acid
CID 138734563
31-hydroxyhentriacontanoic acid
CID 71339995
hexane-1,6-diol;tetradecanedioic acid
CID 158984327
butane-1,4-diol;hexanedioic acid;bis(hexane-1,6-diol)
CID 161164712
4-[2-[11-[2-(3-carboxypropylamino)ethylamino]undecylamino]ethylamino]butanoic acid
CID 87391029
ethane-1,2-diol;hexanedioic acid;hexane-1,6-diol
CID 174881937
butanedioic acid;butane-1,4-diol;decanedioic acid
CID 175347429
12-hydroxydodecanoic acid;zinc
CID 88673734

Frequently Asked Questions

What is the IUPAC name of 5-(5-hydroxypentylamino)pentanoic acid?
The IUPAC name of 5-(5-hydroxypentylamino)pentanoic acid (CID 107318223) is 5-(5-hydroxypentylamino)pentanoic acid.
What is the SMILES notation for 5-(5-hydroxypentylamino)pentanoic acid?
The canonical SMILES for 5-(5-hydroxypentylamino)pentanoic acid is O=C(O)CCCCNCCCCCO.
What is the InChIKey of 5-(5-hydroxypentylamino)pentanoic acid?
The InChIKey is PRCCPRVKZDDRAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3/c12-9-5-1-3-7-11-8-4-2-6-10(13)14/h11-12H,1-9H2,(H,13,14).
What are the key properties of 5-(5-hydroxypentylamino)pentanoic acid?
5-(5-hydroxypentylamino)pentanoic acid has a molecular weight of 203.28 g/mol, XLogP of 0.99, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-hydroxypentylamino)pentanoic acid is sourced from PubChem (CID 107318223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).