C10H19NO3S — CID 103265743
ethyl 2-[(2-methylsulfinylpropylamino)methyl]prop-2-enoate (PubChem CID 103265743) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is ethyl 2-[(2-methylsulfinylpropylamino)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(2-methylsulfinylpropylamino)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 103265743 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | ethyl 2-[(2-methylsulfinylpropylamino)methyl]prop-2-enoate |
| SMILES | C=C(CNCC(C)S(C)=O)C(=O)OCC |
| InChI | InChI=1S/C10H19NO3S/c1-5-14-10(12)8(2)6-11-7-9(3)15(4)13/h9,11H,2,5-7H2,1,3-4H3 |
| InChIKey | JLVQKWXMKBSQSG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|