C12H17NO5 — CID 103266355
2-[[(3-methoxyoxolan-3-yl)methylamino]methyl]furan-3-carboxylic acid (PubChem CID 103266355) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[[(3-methoxyoxolan-3-yl)methylamino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-[[(3-methoxyoxolan-3-yl)methylamino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 103266355 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-[[(3-methoxyoxolan-3-yl)methylamino]methyl]furan-3-carboxylic acid |
| SMILES | COC1(CNCc2occc2C(=O)O)CCOC1 |
| InChI | InChI=1S/C12H17NO5/c1-16-12(3-5-17-8-12)7-13-6-10-9(11(14)15)2-4-18-10/h2,4,13H,3,5-8H2,1H3,(H,14,15) |
| InChIKey | SPLMQWYOQLSBKM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |