C9H19N3O3 — CID 103266375
2-amino-3-[(3-methoxyoxolan-3-yl)methylamino]propanamide (PubChem CID 103266375) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-amino-3-[(3-methoxyoxolan-3-yl)methylamino]propanamide.
| Compound Name | 2-amino-3-[(3-methoxyoxolan-3-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 103266375 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 2-amino-3-[(3-methoxyoxolan-3-yl)methylamino]propanamide |
| SMILES | COC1(CNCC(N)C(N)=O)CCOC1 |
| InChI | InChI=1S/C9H19N3O3/c1-14-9(2-3-15-6-9)5-12-4-7(10)8(11)13/h7,12H,2-6,10H2,1H3,(H2,11,13) |
| InChIKey | WEZULWUGORMNJM-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |