C11H13NO2S — CID 103266554
5-[(pent-3-ynylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 103266554) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 5-[(pent-3-ynylamino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(pent-3-ynylamino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103266554 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 5-[(pent-3-ynylamino)methyl]thiophene-2-carboxylic acid |
| SMILES | CC#CCCNCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C11H13NO2S/c1-2-3-4-7-12-8-9-5-6-10(15-9)11(13)14/h5-6,12H,4,7-8H2,1H3,(H,13,14) |
| InChIKey | GMQQHUHRSYOMCR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|