C15H19NO2 — CID 103266589
2-[4-[(pent-3-ynylamino)methyl]phenyl]propanoic acid (PubChem CID 103266589) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-[4-[(pent-3-ynylamino)methyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[(pent-3-ynylamino)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 103266589 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[4-[(pent-3-ynylamino)methyl]phenyl]propanoic acid |
| SMILES | CC#CCCNCc1ccc(C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO2/c1-3-4-5-10-16-11-13-6-8-14(9-7-13)12(2)15(17)18/h6-9,12,16H,5,10-11H2,1-2H3,(H,17,18) |
| InChIKey | GLWZFZKEWJKMJV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|