C16H21N3O2 — CID 106105581
2-[4-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]phenyl]propanoic acid (PubChem CID 106105581) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[4-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 106105581 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[4-[[2-(1-methylpyrazol-3-yl)ethylamino]methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CNCCc2ccn(C)n2)cc1 |
| InChI | InChI=1S/C16H21N3O2/c1-12(16(20)21)14-5-3-13(4-6-14)11-17-9-7-15-8-10-19(2)18-15/h3-6,8,10,12,17H,7,9,11H2,1-2H3,(H,20,21) |
| InChIKey | QJZYEXRCPIFTNT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|