C8H14N2O3 — CID 103267449
(E)-4-[(4-amino-4-oxobutan-2-yl)amino]but-2-enoic acid (PubChem CID 103267449) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is (E)-4-[(4-amino-4-oxobutan-2-yl)amino]but-2-enoic acid.
| Compound Name | (E)-4-[(4-amino-4-oxobutan-2-yl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 103267449 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (E)-4-[(4-amino-4-oxobutan-2-yl)amino]but-2-enoic acid |
| SMILES | CC(CC(N)=O)NC/C=C/C(=O)O |
| InChI | InChI=1S/C8H14N2O3/c1-6(5-7(9)11)10-4-2-3-8(12)13/h2-3,6,10H,4-5H2,1H3,(H2,9,11)(H,12,13)/b3-2+ |
| InChIKey | OSXSHXSYDRWPJY-NSCUHMNNSA-N |
| XLogP | -0.52 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|