C11H21NO4 — CID 103268448
5-[(2-hydroxypentylamino)methyl]oxolane-2-carboxylic acid (PubChem CID 103268448) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 5-[(2-hydroxypentylamino)methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(2-hydroxypentylamino)methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 103268448 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 5-[(2-hydroxypentylamino)methyl]oxolane-2-carboxylic acid |
| SMILES | CCCC(O)CNCC1CCC(C(=O)O)O1 |
| InChI | InChI=1S/C11H21NO4/c1-2-3-8(13)6-12-7-9-4-5-10(16-9)11(14)15/h8-10,12-13H,2-7H2,1H3,(H,14,15) |
| InChIKey | DEPLVGQJPAISQJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |