C12H19NO3 — CID 106231891
5-[(hex-1-yn-3-ylamino)methyl]oxolane-2-carboxylic acid (PubChem CID 106231891) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 5-[(hex-1-yn-3-ylamino)methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(hex-1-yn-3-ylamino)methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 106231891 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 5-[(hex-1-yn-3-ylamino)methyl]oxolane-2-carboxylic acid |
| SMILES | C#CC(CCC)NCC1CCC(C(=O)O)O1 |
| InChI | InChI=1S/C12H19NO3/c1-3-5-9(4-2)13-8-10-6-7-11(16-10)12(14)15/h2,9-11,13H,3,5-8H2,1H3,(H,14,15) |
| InChIKey | ANTLZBBTHPKEQK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|