C11H20F3NO2 — CID 103271276
3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethoxy)ethyl]cyclobutan-1-amine (PubChem CID 103271276) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethoxy)ethyl]cyclobutan-1-amine.
| Compound Name | 3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethoxy)ethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 103271276 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethoxy)ethyl]cyclobutan-1-amine |
| SMILES | CCOC1CC(NCCOC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C11H20F3NO2/c1-4-16-9-7-8(10(9,2)3)15-5-6-17-11(12,13)14/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | CWSICNUXMCSEGS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|