C12H12Br2O3 — CID 103272583
2-[1-(2,4-dibromophenoxy)cyclobutyl]acetic acid (PubChem CID 103272583) has the molecular formula C12H12Br2O3 and a molecular weight of 364.03 g/mol. Its IUPAC name is 2-[1-(2,4-dibromophenoxy)cyclobutyl]acetic acid.
| Compound Name | 2-[1-(2,4-dibromophenoxy)cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 103272583 |
| Molecular Formula | C12H12Br2O3 |
| Molecular Weight | 364.03 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | 2-[1-(2,4-dibromophenoxy)cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(Oc2ccc(Br)cc2Br)CCC1 |
| InChI | InChI=1S/C12H12Br2O3/c13-8-2-3-10(9(14)6-8)17-12(4-1-5-12)7-11(15)16/h2-3,6H,1,4-5,7H2,(H,15,16) |
| InChIKey | JATOIQGJZAYCTA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.03 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |