C14H17ClO3 — CID 103272729
methyl 2-[1-(2-chloro-4-methylphenoxy)cyclobutyl]acetate (PubChem CID 103272729) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is methyl 2-[1-(2-chloro-4-methylphenoxy)cyclobutyl]acetate.
| Compound Name | methyl 2-[1-(2-chloro-4-methylphenoxy)cyclobutyl]acetate |
|---|---|
| PubChem CID | 103272729 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | methyl 2-[1-(2-chloro-4-methylphenoxy)cyclobutyl]acetate |
| SMILES | COC(=O)CC1(Oc2ccc(C)cc2Cl)CCC1 |
| InChI | InChI=1S/C14H17ClO3/c1-10-4-5-12(11(15)8-10)18-14(6-3-7-14)9-13(16)17-2/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | OCBIRVYAINKOSB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |