C15H13BrFNOS — CID 103274665
N-(5-bromo-4-fluoro-2-methylphenyl)-2-phenylsulfanylacetamide (PubChem CID 103274665) has the molecular formula C15H13BrFNOS and a molecular weight of 354.24 g/mol. Its IUPAC name is N-(5-bromo-4-fluoro-2-methylphenyl)-2-phenylsulfanylacetamide.
| Compound Name | N-(5-bromo-4-fluoro-2-methylphenyl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 103274665 |
| Molecular Formula | C15H13BrFNOS |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | N-(5-bromo-4-fluoro-2-methylphenyl)-2-phenylsulfanylacetamide |
| SMILES | Cc1cc(F)c(Br)cc1NC(=O)CSc1ccccc1 |
| InChI | InChI=1S/C15H13BrFNOS/c1-10-7-13(17)12(16)8-14(10)18-15(19)9-20-11-5-3-2-4-6-11/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | LVHVYKHRFGYDEJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |