C15H16BrFN2O2 — CID 103275885
4-[(5-bromo-4-fluoro-2-methylanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol (PubChem CID 103275885) has the molecular formula C15H16BrFN2O2 and a molecular weight of 355.21 g/mol. Its IUPAC name is 4-[(5-bromo-4-fluoro-2-methylanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol.
| Compound Name | 4-[(5-bromo-4-fluoro-2-methylanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
|---|---|
| PubChem CID | 103275885 |
| Molecular Formula | C15H16BrFN2O2 |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-[(5-bromo-4-fluoro-2-methylanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
| SMILES | Cc1cc(F)c(Br)cc1NCc1c(CO)cnc(C)c1O |
| InChI | InChI=1S/C15H16BrFN2O2/c1-8-3-13(17)12(16)4-14(8)19-6-11-10(7-20)5-18-9(2)15(11)21/h3-5,19-21H,6-7H2,1-2H3 |
| InChIKey | FJQKUHQTOQVGPD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |