About 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol
4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol (PubChem CID 107572749) has the molecular formula C14H13Cl2FN2O2
and a molecular weight of 331.17 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol.
Molecular Properties
| Compound Name | 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
| PubChem CID | 107572749 |
| Molecular Formula | C14H13Cl2FN2O2 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
| SMILES | Cc1ncc(CO)c(CNc2cc(Cl)c(F)c(Cl)c2)c1O |
| InChI | InChI=1S/C14H13Cl2FN2O2/c1-7-14(21)10(8(6-20)4-18-7)5-19-9-2-11(15)13(17)12(16)3-9/h2-4,19-21H,5-6H2,1H3 |
| InChIKey | OTJHHYMJYFSBCU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
The IUPAC name of 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol (CID 107572749) is 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol.
What is the SMILES notation for 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
The canonical SMILES for 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol is Cc1ncc(CO)c(CNc2cc(Cl)c(F)c(Cl)c2)c1O.
What is the InChIKey of 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
The InChIKey is OTJHHYMJYFSBCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2FN2O2/c1-7-14(21)10(8(6-20)4-18-7)5-19-9-2-11(15)13(17)12(16)3-9/h2-4,19-21H,5-6H2,1H3.
What are the key properties of 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol has a molecular weight of 331.17 g/mol, XLogP of 3.65, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dichloro-4-fluoroanilino)methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol is sourced from PubChem (CID 107572749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).