C12H20F3N — CID 103276776
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 103276776) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 103276776 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | CC1=CC(C)CC(CNCCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3N/c1-9-5-10(2)7-11(6-9)8-16-4-3-12(13,14)15/h5,9,11,16H,3-4,6-8H2,1-2H3 |
| InChIKey | ZHDOHYQZNZBJRW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|