C13H21N3 — CID 103276866
1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(1H-imidazol-5-ylmethyl)methanamine (PubChem CID 103276866) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(1H-imidazol-5-ylmethyl)methanamine.
| Compound Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(1H-imidazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 103276866 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(1H-imidazol-5-ylmethyl)methanamine |
| SMILES | CC1=CC(C)CC(CNCc2cnc[nH]2)C1 |
| InChI | InChI=1S/C13H21N3/c1-10-3-11(2)5-12(4-10)6-14-7-13-8-15-9-16-13/h3,8-10,12,14H,4-7H2,1-2H3,(H,15,16) |
| InChIKey | PCLHGIFFEVFZMS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|