About (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine
(1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine (PubChem CID 103276963) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine.
Molecular Properties
| Compound Name | (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine |
| PubChem CID | 103276963 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine |
| SMILES | CC1=CC(C)CC(CN[C@@H](C)c2ccncc2)C1 |
| InChI | InChI=1S/C16H24N2/c1-12-8-13(2)10-15(9-12)11-18-14(3)16-4-6-17-7-5-16/h4-8,12,14-15,18H,9-11H2,1-3H3/t12?,14-,15?/m0/s1 |
| InChIKey | RQCASTZVNKJKFH-BLZCZZARSA-N |
| XLogP | 3.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine?
The IUPAC name of (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine (CID 103276963) is (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine.
What is the SMILES notation for (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine?
The canonical SMILES for (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine is CC1=CC(C)CC(CN[C@@H](C)c2ccncc2)C1.
What is the InChIKey of (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine?
The InChIKey is RQCASTZVNKJKFH-BLZCZZARSA-N. The full InChI is InChI=1S/C16H24N2/c1-12-8-13(2)10-15(9-12)11-18-14(3)16-4-6-17-7-5-16/h4-8,12,14-15,18H,9-11H2,1-3H3/t12?,14-,15?/m0/s1.
What are the key properties of (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine?
(1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine has a molecular weight of 244.38 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1-pyridin-4-ylethanamine is sourced from PubChem (CID 103276963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).