C11H19F2N — CID 103276980
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-difluoroethanamine (PubChem CID 103276980) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 103276980 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-difluoroethanamine |
| SMILES | CC1=CC(C)CC(CNCC(F)F)C1 |
| InChI | InChI=1S/C11H19F2N/c1-8-3-9(2)5-10(4-8)6-14-7-11(12)13/h3,8,10-11,14H,4-7H2,1-2H3 |
| InChIKey | WLQCISBEEAXQMK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|