C14H24F3N — CID 103276983
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 103276983) has the molecular formula C14H24F3N and a molecular weight of 263.35 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 103276983 |
| Molecular Formula | C14H24F3N |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | CC1=CC(C)CC(CNCCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H24F3N/c1-11-7-12(2)9-13(8-11)10-18-6-4-3-5-14(15,16)17/h7,11,13,18H,3-6,8-10H2,1-2H3 |
| InChIKey | UJLKSFOCEQCXNB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|