C16H30N2O2 — CID 103277291
2-[2-(diethylamino)ethylamino]-2-(3,5-dimethylcyclohex-3-en-1-yl)acetic acid (PubChem CID 103277291) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-2-(3,5-dimethylcyclohex-3-en-1-yl)acetic acid.
| Compound Name | 2-[2-(diethylamino)ethylamino]-2-(3,5-dimethylcyclohex-3-en-1-yl)acetic acid |
|---|---|
| PubChem CID | 103277291 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-2-(3,5-dimethylcyclohex-3-en-1-yl)acetic acid |
| SMILES | CCN(CC)CCNC(C(=O)O)C1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-5-18(6-2)8-7-17-15(16(19)20)14-10-12(3)9-13(4)11-14/h9,12,14-15,17H,5-8,10-11H2,1-4H3,(H,19,20) |
| InChIKey | FOMDWTDGTHFIJN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|