C17H23NO2 — CID 103277276
methyl 2-anilino-2-(3,5-dimethylcyclohex-3-en-1-yl)acetate (PubChem CID 103277276) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is methyl 2-anilino-2-(3,5-dimethylcyclohex-3-en-1-yl)acetate.
| Compound Name | methyl 2-anilino-2-(3,5-dimethylcyclohex-3-en-1-yl)acetate |
|---|---|
| PubChem CID | 103277276 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | methyl 2-anilino-2-(3,5-dimethylcyclohex-3-en-1-yl)acetate |
| SMILES | COC(=O)C(Nc1ccccc1)C1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C17H23NO2/c1-12-9-13(2)11-14(10-12)16(17(19)20-3)18-15-7-5-4-6-8-15/h4-9,12,14,16,18H,10-11H2,1-3H3 |
| InChIKey | RTRXIWVXZNDXSZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|