C16H23NO2S — CID 103277317
methyl 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(thiophen-2-ylmethylamino)acetate (PubChem CID 103277317) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is methyl 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(thiophen-2-ylmethylamino)acetate.
| Compound Name | methyl 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(thiophen-2-ylmethylamino)acetate |
|---|---|
| PubChem CID | 103277317 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(thiophen-2-ylmethylamino)acetate |
| SMILES | COC(=O)C(NCc1cccs1)C1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C16H23NO2S/c1-11-7-12(2)9-13(8-11)15(16(18)19-3)17-10-14-5-4-6-20-14/h4-7,11,13,15,17H,8-10H2,1-3H3 |
| InChIKey | QNMWTJCSUWXHPW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|