C16H27NO2 — CID 103277729
2-(azepan-1-yl)-2-(3,5-dimethylcyclohex-3-en-1-yl)acetic acid (PubChem CID 103277729) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-(azepan-1-yl)-2-(3,5-dimethylcyclohex-3-en-1-yl)acetic acid.
| Compound Name | 2-(azepan-1-yl)-2-(3,5-dimethylcyclohex-3-en-1-yl)acetic acid |
|---|---|
| PubChem CID | 103277729 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-(azepan-1-yl)-2-(3,5-dimethylcyclohex-3-en-1-yl)acetic acid |
| SMILES | CC1=CC(C)CC(C(C(=O)O)N2CCCCCC2)C1 |
| InChI | InChI=1S/C16H27NO2/c1-12-9-13(2)11-14(10-12)15(16(18)19)17-7-5-3-4-6-8-17/h9,12,14-15H,3-8,10-11H2,1-2H3,(H,18,19) |
| InChIKey | SHDZLPJGHKETOO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|